Pigment yellow 65 – Corimax Yellow RN
Technical parameters of Pigment yellow 65
| Barvni indeks št. | Pigmentno rumena 65 |
| Ime izdelka | Corimax Yellow RN |
| Kategorija izdelkov | Ekološki pigment |
| Številka CAS | 6528-34-3 |
| Številka EU | 229-419-9 |
| Kemična družina | Monazo |
| Molekularna teža | 386.36 |
| Molekularna formula | C18H18N4O6 |
| PH vrednost | 6.0-7.0 |
| Gostota | 1.6 |
| Absorpcija olja (ml / 100 g)% | 35-45 |
| Hitrost svetlobe (premaz) | 7 |
| Toplotna odpornost (premaz) | 140 |
| Vodoodpornost | 5 |
| Odpornost na olje | 3 |
| Odpornost proti kislini | 5 |
| Odpornost proti alkaliji | 5 |
Barva | ![]() |
| Porazdelitev odtenkov |
Lastnosti: Good dispersion.
Uporaba:
Recommended for architectural coatings, industrial coatings.
Povezane informacije
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Molekularna struktura:
Molecular Formula:C18H18N4O6
Molecular Weight: 386.36
CAS Registry Number:6528-34-3
Manufacturing Methods : 4-Methoxy-2-nitrobenzenamine diazotization, and N-(2-methoxyphenyl)-3-oxobutanamide coupling.
Properties and Applications:brilliant red light yellow. Red powder. Sunlight fastness is better. Resistance to Cellosole, kerosene, is not able to bear or endure xylene, acid-proof alkaline better. In oily medium, especially in latex coating in use, also can be used for coating, rubber, cultural and educational supplies coloring.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
Sopomenke
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Izračunane lastnosti
| Ime lastnosti | Vrednost nepremičnine |
| Molekularna teža | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Število donatorjev vodikove vezi | 1 |
| Število sprejemnikov vodikove vezi | 8 |
| Rotacijski števec obveznic | 7 |
| Natančna masa | 386.12263431 Da |
| Monoizotopna masa | 386.12263431 Da |
| Topološka polarna površina | 135 Ų |
| Število težkih atomov | 28 |
| Uradna obtožba | 0 |
| Kompleksnost | 593 |
| Število atomov izotopov | 0 |
| Definirano število atomskih stereocentrov | 0 |
| Nedefinirano število atomskih stereocentrov | 1 |
| Definirano število stereocentrov vezi | 0 |
| Nedefinirano število stereocentrov vezi | 0 |
| Število enot s kovalentno vezjo | 1 |
| Spojina je kanonizirana | ja |











